C18H24ClN3O5S — CID 119976053
N-[2-amino-2-(4-propan-2-ylphenyl)ethyl]-4-methoxy-3-nitrobenzenesulfonamide;hydrochloride (PubChem CID 119976053) has the molecular formula C18H24ClN3O5S and a molecular weight of 429.93 g/mol. Its IUPAC name is N-[2-amino-2-(4-propan-2-ylphenyl)ethyl]-4-methoxy-3-nitrobenzenesulfonamide;hydrochloride.
| Compound Name | N-[2-amino-2-(4-propan-2-ylphenyl)ethyl]-4-methoxy-3-nitrobenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119976053 |
| Molecular Formula | C18H24ClN3O5S |
| Molecular Weight | 429.93 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | N-[2-amino-2-(4-propan-2-ylphenyl)ethyl]-4-methoxy-3-nitrobenzenesulfonamide;hydrochloride |
| SMILES | COc1ccc(S(=O)(=O)NCC(N)c2ccc(C(C)C)cc2)cc1[N+](=O)[O-].Cl |
| InChI | InChI=1S/C18H23N3O5S.ClH/c1-12(2)13-4-6-14(7-5-13)16(19)11-20-27(24,25)15-8-9-18(26-3)17(10-15)21(22)23;/h4-10,12,16,20H,11,19H2,1-3H3;1H |
| InChIKey | REEJVSHOXOBEDJ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 124.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.93 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|