C15H20ClNO4 — CID 21152996
4-(4-chlorophenyl)-4-oxo-2-piperidin-1-ylbutanoic acid;hydrate (PubChem CID 21152996) has the molecular formula C15H20ClNO4 and a molecular weight of 313.78 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-4-oxo-2-piperidin-1-ylbutanoic acid;hydrate.
| Compound Name | 4-(4-chlorophenyl)-4-oxo-2-piperidin-1-ylbutanoic acid;hydrate |
|---|---|
| PubChem CID | 21152996 |
| Molecular Formula | C15H20ClNO4 |
| Molecular Weight | 313.78 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 4-(4-chlorophenyl)-4-oxo-2-piperidin-1-ylbutanoic acid;hydrate |
| SMILES | O.O=C(CC(C(=O)O)N1CCCCC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H18ClNO3.H2O/c16-12-6-4-11(5-7-12)14(18)10-13(15(19)20)17-8-2-1-3-9-17;/h4-7,13H,1-3,8-10H2,(H,19,20);1H2 |
| InChIKey | JODZJZHCYKOEOF-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 89.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.78 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |