C15H18Cl2N2O3 — CID 7591841
(2R)-4-(2,5-dichloroanilino)-4-oxo-2-piperidin-1-ylbutanoic acid (PubChem CID 7591841) has the molecular formula C15H18Cl2N2O3 and a molecular weight of 345.23 g/mol. Its IUPAC name is (2R)-4-(2,5-dichloroanilino)-4-oxo-2-piperidin-1-ylbutanoic acid.
| Compound Name | (2R)-4-(2,5-dichloroanilino)-4-oxo-2-piperidin-1-ylbutanoic acid |
|---|---|
| PubChem CID | 7591841 |
| Molecular Formula | C15H18Cl2N2O3 |
| Molecular Weight | 345.23 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | (2R)-4-(2,5-dichloroanilino)-4-oxo-2-piperidin-1-ylbutanoic acid |
| SMILES | O=C(C[C@H](C(=O)O)N1CCCCC1)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C15H18Cl2N2O3/c16-10-4-5-11(17)12(8-10)18-14(20)9-13(15(21)22)19-6-2-1-3-7-19/h4-5,8,13H,1-3,6-7,9H2,(H,18,20)(H,21,22)/t13-/m1/s1 |
| InChIKey | MUEJGESZZRDCOR-CYBMUJFWSA-N |
| XLogP | 3.26 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.23 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |