C21H32N2O5S — CID 21154468
ethyl 3-[[[2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]-2-oxoethyl]amino]sulfanyl-(2-methylpropyl)amino]propanoate (PubChem CID 21154468) has the molecular formula C21H32N2O5S and a molecular weight of 424.56 g/mol. Its IUPAC name is ethyl 3-[[[2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]-2-oxoethyl]amino]sulfanyl-(2-methylpropyl)amino]propanoate.
| Compound Name | ethyl 3-[[[2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]-2-oxoethyl]amino]sulfanyl-(2-methylpropyl)amino]propanoate |
|---|---|
| PubChem CID | 21154468 |
| Molecular Formula | C21H32N2O5S |
| Molecular Weight | 424.56 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | ethyl 3-[[[2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]-2-oxoethyl]amino]sulfanyl-(2-methylpropyl)amino]propanoate |
| SMILES | CCOC(=O)CCN(CC(C)C)SNCC(=O)Oc1cccc2c1OC(C)(C)C2 |
| InChI | InChI=1S/C21H32N2O5S/c1-6-26-18(24)10-11-23(14-15(2)3)29-22-13-19(25)27-17-9-7-8-16-12-21(4,5)28-20(16)17/h7-9,15,22H,6,10-14H2,1-5H3 |
| InChIKey | WRTIFNHRADSGII-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.56 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|