C23H34N2O5S — CID 90477496
ethyl 3-[cyclohexyl-[[2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]-2-oxoethyl]amino]sulfanylamino]propanoate (PubChem CID 90477496) has the molecular formula C23H34N2O5S and a molecular weight of 450.60 g/mol. Its IUPAC name is ethyl 3-[cyclohexyl-[[2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]-2-oxoethyl]amino]sulfanylamino]propanoate.
| Compound Name | ethyl 3-[cyclohexyl-[[2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]-2-oxoethyl]amino]sulfanylamino]propanoate |
|---|---|
| PubChem CID | 90477496 |
| Molecular Formula | C23H34N2O5S |
| Molecular Weight | 450.60 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | ethyl 3-[cyclohexyl-[[2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]-2-oxoethyl]amino]sulfanylamino]propanoate |
| SMILES | CCOC(=O)CCN(SNCC(=O)Oc1cccc2c1OC(C)(C)C2)C1CCCCC1 |
| InChI | InChI=1S/C23H34N2O5S/c1-4-28-20(26)13-14-25(18-10-6-5-7-11-18)31-24-16-21(27)29-19-12-8-9-17-15-23(2,3)30-22(17)19/h8-9,12,18,24H,4-7,10-11,13-16H2,1-3H3 |
| InChIKey | ZQNPGPTVHMTYNT-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.60 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|