C13H17NO4S-2 — CID 21155167
4-(2-butan-2-ylsulfanylethyl)pyridine;oxalate (PubChem CID 21155167) has the molecular formula C13H17NO4S-2 and a molecular weight of 283.35 g/mol. Its IUPAC name is 4-(2-butan-2-ylsulfanylethyl)pyridine;oxalate.
| Compound Name | 4-(2-butan-2-ylsulfanylethyl)pyridine;oxalate |
|---|---|
| PubChem CID | 21155167 |
| Molecular Formula | C13H17NO4S-2 |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 4-(2-butan-2-ylsulfanylethyl)pyridine;oxalate |
| SMILES | CCC(C)SCCc1ccncc1.O=C([O-])C(=O)[O-] |
| InChI | InChI=1S/C11H17NS.C2H2O4/c1-3-10(2)13-9-6-11-4-7-12-8-5-11;3-1(4)2(5)6/h4-5,7-8,10H,3,6,9H2,1-2H3;(H,3,4)(H,5,6)/p-2 |
| InChIKey | YGMAOUKOXNOSDI-UHFFFAOYSA-L |
| XLogP | -0.36 |
| TPSA | 93.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|