C25H31F3O5 — CID 21157494
[(8R,9S,10R,13S,14S,16Z)-16-(1-acetyloxy-2,2,2-trifluoroethylidene)-10,13-dimethyl-17-oxo-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 21157494) has the molecular formula C25H31F3O5 and a molecular weight of 468.51 g/mol. Its IUPAC name is [(8R,9S,10R,13S,14S,16Z)-16-(1-acetyloxy-2,2,2-trifluoroethylidene)-10,13-dimethyl-17-oxo-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(8R,9S,10R,13S,14S,16Z)-16-(1-acetyloxy-2,2,2-trifluoroethylidene)-10,13-dimethyl-17-oxo-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 21157494 |
| Molecular Formula | C25H31F3O5 |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.21 |
| IUPAC Name | [(8R,9S,10R,13S,14S,16Z)-16-(1-acetyloxy-2,2,2-trifluoroethylidene)-10,13-dimethyl-17-oxo-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)O/C(=C1/C[C@H]2[C@@H]3CC=C4CC(OC(C)=O)CC[C@]4(C)[C@H]3CC[C@]2(C)C1=O)C(F)(F)F |
| InChI | InChI=1S/C25H31F3O5/c1-13(29)32-16-7-9-23(3)15(11-16)5-6-17-19(23)8-10-24(4)20(17)12-18(21(24)31)22(25(26,27)28)33-14(2)30/h5,16-17,19-20H,6-12H2,1-4H3/b22-18-/t16?,17-,19+,20+,23+,24+/m1/s1 |
| InChIKey | NBJBKSDSMJNQOA-AKWUKBINSA-N |
| XLogP | 5.44 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|