C23H30O5 — CID 5385954
(2E)-2-(3-acetyloxy-10,13-dimethyl-17-oxo-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-16-ylidene)acetic acid (PubChem CID 5385954) has the molecular formula C23H30O5 and a molecular weight of 386.49 g/mol. Its IUPAC name is (2E)-2-(3-acetyloxy-10,13-dimethyl-17-oxo-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-16-ylidene)acetic acid.
| Compound Name | (2E)-2-(3-acetyloxy-10,13-dimethyl-17-oxo-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-16-ylidene)acetic acid |
|---|---|
| PubChem CID | 5385954 |
| Molecular Formula | C23H30O5 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | (2E)-2-(3-acetyloxy-10,13-dimethyl-17-oxo-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-16-ylidene)acetic acid |
| SMILES | CC(=O)OC1CCC2(C)C(=CCC3C4C/C(=C\C(=O)O)C(=O)C4(C)CCC32)C1 |
| InChI | InChI=1S/C23H30O5/c1-13(24)28-16-6-8-22(2)15(12-16)4-5-17-18(22)7-9-23(3)19(17)10-14(21(23)27)11-20(25)26/h4,11,16-19H,5-10,12H2,1-3H3,(H,25,26)/b14-11+ |
| InChIKey | WFBQLTRVAIINMK-SDNWHVSQSA-N |
| XLogP | 4.07 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|