C32H36O3 — CID 124906666
[(3S,8S,9R,10R,13R,14R,16E)-10,13-dimethyl-16-(naphthalen-2-ylmethylidene)-17-oxo-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 124906666) has the molecular formula C32H36O3 and a molecular weight of 468.64 g/mol. Its IUPAC name is [(3S,8S,9R,10R,13R,14R,16E)-10,13-dimethyl-16-(naphthalen-2-ylmethylidene)-17-oxo-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3S,8S,9R,10R,13R,14R,16E)-10,13-dimethyl-16-(naphthalen-2-ylmethylidene)-17-oxo-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 124906666 |
| Molecular Formula | C32H36O3 |
| Molecular Weight | 468.64 g/mol |
| Exact Mass | 468.27 |
| IUPAC Name | [(3S,8S,9R,10R,13R,14R,16E)-10,13-dimethyl-16-(naphthalen-2-ylmethylidene)-17-oxo-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@@]2(C)C(=CC[C@@H]3[C@H]4C/C(=C\c5ccc6ccccc6c5)C(=O)[C@]4(C)CC[C@H]32)C1 |
| InChI | InChI=1S/C32H36O3/c1-20(33)35-26-12-14-31(2)25(19-26)10-11-27-28(31)13-15-32(3)29(27)18-24(30(32)34)17-21-8-9-22-6-4-5-7-23(22)16-21/h4-10,16-17,26-29H,11-15,18-19H2,1-3H3/b24-17+/t26-,27-,28+,29+,31-,32+/m0/s1 |
| InChIKey | DZYXGWASXRYMFK-KBMRDGIGSA-N |
| XLogP | 7.30 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.64 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|