C26H34N2O3 — CID 99567325
[(3R,8R,9S,10R,13S,14S,16E)-10,13-dimethyl-16-[(2-methylpyrazol-3-yl)methylidene]-17-oxo-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 99567325) has the molecular formula C26H34N2O3 and a molecular weight of 422.57 g/mol. Its IUPAC name is [(3R,8R,9S,10R,13S,14S,16E)-10,13-dimethyl-16-[(2-methylpyrazol-3-yl)methylidene]-17-oxo-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3R,8R,9S,10R,13S,14S,16E)-10,13-dimethyl-16-[(2-methylpyrazol-3-yl)methylidene]-17-oxo-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 99567325 |
| Molecular Formula | C26H34N2O3 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.26 |
| IUPAC Name | [(3R,8R,9S,10R,13S,14S,16E)-10,13-dimethyl-16-[(2-methylpyrazol-3-yl)methylidene]-17-oxo-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CC[C@@]2(C)C(=CC[C@@H]3[C@@H]2CC[C@]2(C)C(=O)/C(=C/c4ccnn4C)C[C@@H]32)C1 |
| InChI | InChI=1S/C26H34N2O3/c1-16(29)31-20-7-10-25(2)18(15-20)5-6-21-22(25)8-11-26(3)23(21)14-17(24(26)30)13-19-9-12-27-28(19)4/h5,9,12-13,20-23H,6-8,10-11,14-15H2,1-4H3/b17-13+/t20-,21-,22+,23+,25+,26+/m1/s1 |
| InChIKey | XKCCGTXQWLOSQQ-WISZKZHUSA-N |
| XLogP | 4.88 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|