C18H21N3OS2 — CID 21157505
1-(2-methylphenyl)-1-[(6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonyl)amino]thiourea (PubChem CID 21157505) has the molecular formula C18H21N3OS2 and a molecular weight of 359.52 g/mol. Its IUPAC name is 1-(2-methylphenyl)-1-[(6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonyl)amino]thiourea.
| Compound Name | 1-(2-methylphenyl)-1-[(6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonyl)amino]thiourea |
|---|---|
| PubChem CID | 21157505 |
| Molecular Formula | C18H21N3OS2 |
| Molecular Weight | 359.52 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | 1-(2-methylphenyl)-1-[(6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonyl)amino]thiourea |
| SMILES | Cc1ccccc1N(NC(=O)c1csc2c1CCC(C)C2)C(N)=S |
| InChI | InChI=1S/C18H21N3OS2/c1-11-7-8-13-14(10-24-16(13)9-11)17(22)20-21(18(19)23)15-6-4-3-5-12(15)2/h3-6,10-11H,7-9H2,1-2H3,(H2,19,23)(H,20,22) |
| InChIKey | PGOZIGDZMJTVDE-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.52 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|