C39H48N6O8 — CID 21158213
(2S)-2-[[(2S)-4-amino-2-[[9-[[3-[[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]carbamoyl]phenyl]methylamino]-9-oxononanoyl]amino]-4-oxobutanoyl]amino]-3-phenylpropanoic acid (PubChem CID 21158213) has the molecular formula C39H48N6O8 and a molecular weight of 728.85 g/mol. Its IUPAC name is (2S)-2-[[(2S)-4-amino-2-[[9-[[3-[[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]carbamoyl]phenyl]methylamino]-9-oxononanoyl]amino]-4-oxobutanoyl]amino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[[(2S)-4-amino-2-[[9-[[3-[[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]carbamoyl]phenyl]methylamino]-9-oxononanoyl]amino]-4-oxobutanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 21158213 |
| Molecular Formula | C39H48N6O8 |
| Molecular Weight | 728.85 g/mol |
| Exact Mass | 728.35 |
| IUPAC Name | (2S)-2-[[(2S)-4-amino-2-[[9-[[3-[[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]carbamoyl]phenyl]methylamino]-9-oxononanoyl]amino]-4-oxobutanoyl]amino]-3-phenylpropanoic acid |
| SMILES | NC(=O)C[C@H](NC(=O)CCCCCCCC(=O)NCc1cccc(C(=O)N[C@@H](Cc2ccccc2)C(N)=O)c1)C(=O)N[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C39H48N6O8/c40-33(46)24-31(38(51)45-32(39(52)53)23-27-15-8-5-9-16-27)43-35(48)20-11-3-1-2-10-19-34(47)42-25-28-17-12-18-29(21-28)37(50)44-30(36(41)49)22-26-13-6-4-7-14-26/h4-9,12-18,21,30-32H,1-3,10-11,19-20,22-25H2,(H2,40,46)(H2,41,49)(H,42,47)(H,43,48)(H,44,50)(H,45,51)(H,52,53)/t30-,31-,32-/m0/s1 |
| InChIKey | QVQAWJKULKOJNA-CPCREDONSA-N |
| XLogP | 2.03 |
| TPSA | 239.88 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.85 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|