C24H39N5O4 — CID 21158372
3-[1-acetamido-2-[methyl(6-phenylhexyl)amino]-2-oxoethyl]-4-(diaminomethylamino)cyclopentane-1-carboxylic acid (PubChem CID 21158372) has the molecular formula C24H39N5O4 and a molecular weight of 461.61 g/mol. Its IUPAC name is 3-[1-acetamido-2-[methyl(6-phenylhexyl)amino]-2-oxoethyl]-4-(diaminomethylamino)cyclopentane-1-carboxylic acid.
| Compound Name | 3-[1-acetamido-2-[methyl(6-phenylhexyl)amino]-2-oxoethyl]-4-(diaminomethylamino)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 21158372 |
| Molecular Formula | C24H39N5O4 |
| Molecular Weight | 461.61 g/mol |
| Exact Mass | 461.30 |
| IUPAC Name | 3-[1-acetamido-2-[methyl(6-phenylhexyl)amino]-2-oxoethyl]-4-(diaminomethylamino)cyclopentane-1-carboxylic acid |
| SMILES | CC(=O)NC(C(=O)N(C)CCCCCCc1ccccc1)C1CC(C(=O)O)CC1NC(N)N |
| InChI | InChI=1S/C24H39N5O4/c1-16(30)27-21(19-14-18(23(32)33)15-20(19)28-24(25)26)22(31)29(2)13-9-4-3-6-10-17-11-7-5-8-12-17/h5,7-8,11-12,18-21,24,28H,3-4,6,9-10,13-15,25-26H2,1-2H3,(H,27,30)(H,32,33) |
| InChIKey | BVGTXDZXGCTPNK-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 150.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.61 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|