C23H48O5Si3 — CID 21160104
bis[tert-butyl(dimethyl)silyl] (Z)-2-[tert-butyl(dimethyl)silyl]oxypent-2-enedioate (PubChem CID 21160104) has the molecular formula C23H48O5Si3 and a molecular weight of 488.89 g/mol. Its IUPAC name is bis[tert-butyl(dimethyl)silyl] (Z)-2-[tert-butyl(dimethyl)silyl]oxypent-2-enedioate.
| Compound Name | bis[tert-butyl(dimethyl)silyl] (Z)-2-[tert-butyl(dimethyl)silyl]oxypent-2-enedioate |
|---|---|
| PubChem CID | 21160104 |
| Molecular Formula | C23H48O5Si3 |
| Molecular Weight | 488.89 g/mol |
| Exact Mass | 488.28 |
| IUPAC Name | bis[tert-butyl(dimethyl)silyl] (Z)-2-[tert-butyl(dimethyl)silyl]oxypent-2-enedioate |
| SMILES | CC(C)(C)[Si](C)(C)OC(=O)C/C=C(\O[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H48O5Si3/c1-21(2,3)29(10,11)26-18(20(25)28-31(14,15)23(7,8)9)16-17-19(24)27-30(12,13)22(4,5)6/h16H,17H2,1-15H3/b18-16- |
| InChIKey | ZROFXMRAYAXTRJ-VLGSPTGOSA-N |
| XLogP | 7.38 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.89 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|