C16H9N3O4S2 — CID 21160233
(5Z)-5-[(3-nitrophenyl)methylidene]-3-(pyridine-3-carbonyl)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 21160233) has the molecular formula C16H9N3O4S2 and a molecular weight of 371.40 g/mol. Its IUPAC name is (5Z)-5-[(3-nitrophenyl)methylidene]-3-(pyridine-3-carbonyl)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(3-nitrophenyl)methylidene]-3-(pyridine-3-carbonyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 21160233 |
| Molecular Formula | C16H9N3O4S2 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.00 |
| IUPAC Name | (5Z)-5-[(3-nitrophenyl)methylidene]-3-(pyridine-3-carbonyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C/c2cccc([N+](=O)[O-])c2)SC(=S)N1C(=O)c1cccnc1 |
| InChI | InChI=1S/C16H9N3O4S2/c20-14(11-4-2-6-17-9-11)18-15(21)13(25-16(18)24)8-10-3-1-5-12(7-10)19(22)23/h1-9H/b13-8- |
| InChIKey | VJLWKCORZRXHHC-JYRVWZFOSA-N |
| XLogP | 3.03 |
| TPSA | 93.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|