C14H20O — CID 21160606
3,7,7-trimethyl-1-[(1E,3E)-penta-1,3-dienyl]-2-oxabicyclo[3.2.0]hept-3-ene (PubChem CID 21160606) has the molecular formula C14H20O and a molecular weight of 204.31 g/mol. Its IUPAC name is 3,7,7-trimethyl-1-[(1E,3E)-penta-1,3-dienyl]-2-oxabicyclo[3.2.0]hept-3-ene.
| Compound Name | 3,7,7-trimethyl-1-[(1E,3E)-penta-1,3-dienyl]-2-oxabicyclo[3.2.0]hept-3-ene |
|---|---|
| PubChem CID | 21160606 |
| Molecular Formula | C14H20O |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | 3,7,7-trimethyl-1-[(1E,3E)-penta-1,3-dienyl]-2-oxabicyclo[3.2.0]hept-3-ene |
| SMILES | C/C=C/C=C/C12OC(C)=CC1CC2(C)C |
| InChI | InChI=1S/C14H20O/c1-5-6-7-8-14-12(9-11(2)15-14)10-13(14,3)4/h5-9,12H,10H2,1-4H3/b6-5+,8-7+ |
| InChIKey | OUJHGCJJBZWAEE-BSWSSELBSA-N |
| XLogP | 3.84 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|