C9H10FNOS — CID 21161805
S-(4-fluorophenyl) N,N-dimethylcarbamothioate (PubChem CID 21161805) has the molecular formula C9H10FNOS and a molecular weight of 199.25 g/mol. Its IUPAC name is S-(4-fluorophenyl) N,N-dimethylcarbamothioate.
| Compound Name | S-(4-fluorophenyl) N,N-dimethylcarbamothioate |
|---|---|
| PubChem CID | 21161805 |
| Molecular Formula | C9H10FNOS |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.05 |
| IUPAC Name | S-(4-fluorophenyl) N,N-dimethylcarbamothioate |
| SMILES | CN(C)C(=O)Sc1ccc(F)cc1 |
| InChI | InChI=1S/C9H10FNOS/c1-11(2)9(12)13-8-5-3-7(10)4-6-8/h3-6H,1-2H3 |
| InChIKey | CMMPIDZFNVQLQM-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|