C15H11ClN2O2 — CID 21162316
7-chlorobicyclo[4.1.0]hepta-1,3,5-triene;1H-indazole-3-carboxylic acid (PubChem CID 21162316) has the molecular formula C15H11ClN2O2 and a molecular weight of 286.72 g/mol. Its IUPAC name is 7-chlorobicyclo[4.1.0]hepta-1,3,5-triene;1H-indazole-3-carboxylic acid.
| Compound Name | 7-chlorobicyclo[4.1.0]hepta-1,3,5-triene;1H-indazole-3-carboxylic acid |
|---|---|
| PubChem CID | 21162316 |
| Molecular Formula | C15H11ClN2O2 |
| Molecular Weight | 286.72 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | 7-chlorobicyclo[4.1.0]hepta-1,3,5-triene;1H-indazole-3-carboxylic acid |
| SMILES | ClC1c2ccccc21.O=C(O)c1n[nH]c2ccccc12 |
| InChI | InChI=1S/C8H6N2O2.C7H5Cl/c11-8(12)7-5-3-1-2-4-6(5)9-10-7;8-7-5-3-1-2-4-6(5)7/h1-4H,(H,9,10)(H,11,12);1-4,7H |
| InChIKey | ZRRVTYITOQOQKT-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.72 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|