C11H6Cl2O3S — CID 21162534
2-(2,5-dichlorophenyl)sulfanylfuran-3-carboxylic acid (PubChem CID 21162534) has the molecular formula C11H6Cl2O3S and a molecular weight of 289.14 g/mol. Its IUPAC name is 2-(2,5-dichlorophenyl)sulfanylfuran-3-carboxylic acid.
| Compound Name | 2-(2,5-dichlorophenyl)sulfanylfuran-3-carboxylic acid |
|---|---|
| PubChem CID | 21162534 |
| Molecular Formula | C11H6Cl2O3S |
| Molecular Weight | 289.14 g/mol |
| Exact Mass | 287.94 |
| IUPAC Name | 2-(2,5-dichlorophenyl)sulfanylfuran-3-carboxylic acid |
| SMILES | O=C(O)c1ccoc1Sc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C11H6Cl2O3S/c12-6-1-2-8(13)9(5-6)17-11-7(10(14)15)3-4-16-11/h1-5H,(H,14,15) |
| InChIKey | GBXFAUFKWMLTJI-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.14 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |