C15H12Cl2FNOS — CID 1201721
2-(2,5-dichlorophenyl)sulfanyl-5-fluoro-N,N-dimethylbenzamide (PubChem CID 1201721) has the molecular formula C15H12Cl2FNOS and a molecular weight of 344.24 g/mol. Its IUPAC name is 2-(2,5-dichlorophenyl)sulfanyl-5-fluoro-N,N-dimethylbenzamide.
| Compound Name | 2-(2,5-dichlorophenyl)sulfanyl-5-fluoro-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 1201721 |
| Molecular Formula | C15H12Cl2FNOS |
| Molecular Weight | 344.24 g/mol |
| Exact Mass | 343.00 |
| IUPAC Name | 2-(2,5-dichlorophenyl)sulfanyl-5-fluoro-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1cc(F)ccc1Sc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C15H12Cl2FNOS/c1-19(2)15(20)11-8-10(18)4-6-13(11)21-14-7-9(16)3-5-12(14)17/h3-8H,1-2H3 |
| InChIKey | YWWHWGKKDXFPNZ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.24 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |