C15H12F3NOS — CID 54120443
2-(3,4-difluorophenyl)sulfanyl-5-fluoro-N,N-dimethylbenzamide (PubChem CID 54120443) has the molecular formula C15H12F3NOS and a molecular weight of 311.33 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)sulfanyl-5-fluoro-N,N-dimethylbenzamide.
| Compound Name | 2-(3,4-difluorophenyl)sulfanyl-5-fluoro-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 54120443 |
| Molecular Formula | C15H12F3NOS |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | 2-(3,4-difluorophenyl)sulfanyl-5-fluoro-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1cc(F)ccc1Sc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C15H12F3NOS/c1-19(2)15(20)11-7-9(16)3-6-14(11)21-10-4-5-12(17)13(18)8-10/h3-8H,1-2H3 |
| InChIKey | NNICTFUTFLIHBS-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |