C27H19BrF2N2O2S — CID 21169743
N-[4-[2-(4-bromo-2-fluoroanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]-4-fluorobenzamide (PubChem CID 21169743) has the molecular formula C27H19BrF2N2O2S and a molecular weight of 553.43 g/mol. Its IUPAC name is N-[4-[2-(4-bromo-2-fluoroanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]-4-fluorobenzamide.
| Compound Name | N-[4-[2-(4-bromo-2-fluoroanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 21169743 |
| Molecular Formula | C27H19BrF2N2O2S |
| Molecular Weight | 553.43 g/mol |
| Exact Mass | 552.03 |
| IUPAC Name | N-[4-[2-(4-bromo-2-fluoroanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]-4-fluorobenzamide |
| SMILES | O=C(Nc1ccc(SC(C(=O)Nc2ccc(Br)cc2F)c2ccccc2)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C27H19BrF2N2O2S/c28-19-8-15-24(23(30)16-19)32-27(34)25(17-4-2-1-3-5-17)35-22-13-11-21(12-14-22)31-26(33)18-6-9-20(29)10-7-18/h1-16,25H,(H,31,33)(H,32,34) |
| InChIKey | LPPXDEJRTFYJLO-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.43 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |