C12H13NOS2 — CID 211709
5-Methyl-3-(2-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 211709) has the molecular formula C12H13NOS2 and a molecular weight of 251.40 g/mol. Its IUPAC name is 5-methyl-3-(2-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-Methyl-3-(2-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 211709 |
| Molecular Formula | C12H13NOS2 |
| Molecular Weight | 251.40 g/mol |
| Exact Mass | 251.04 |
| IUPAC Name | 5-methyl-3-(2-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CC1C(=O)N(C(=S)S1)CCC2=CC=CC=C2 |
| InChI | InChI=1S/C12H13NOS2/c1-9-11(14)13(12(15)16-9)8-7-10-5-3-2-4-6-10/h2-6,9H,7-8H2,1H3 |
| InChIKey | BSPMWDAFVFMVPU-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 77.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | 287 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.40 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|