C23H29N3O6S — CID 21173604
N-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]ethanesulfonamide (PubChem CID 21173604) has the molecular formula C23H29N3O6S and a molecular weight of 475.57 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]ethanesulfonamide.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]ethanesulfonamide |
|---|---|
| PubChem CID | 21173604 |
| Molecular Formula | C23H29N3O6S |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)N(CC(=O)N1CCN(c2ccc(OC)cc2)CC1)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C23H29N3O6S/c1-3-33(28,29)26(19-6-9-21-22(16-19)32-15-14-31-21)17-23(27)25-12-10-24(11-13-25)18-4-7-20(30-2)8-5-18/h4-9,16H,3,10-15,17H2,1-2H3 |
| InChIKey | SKXGSTIOUIBGAT-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 88.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|