C22H25NO7 — CID 21174865
[2-(4-butoxycarbonylanilino)-2-oxoethyl] (1R,3R,6S,7S,9R)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate (PubChem CID 21174865) has the molecular formula C22H25NO7 and a molecular weight of 415.44 g/mol. Its IUPAC name is [2-(4-butoxycarbonylanilino)-2-oxoethyl] (1R,3R,6S,7S,9R)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate.
| Compound Name | [2-(4-butoxycarbonylanilino)-2-oxoethyl] (1R,3R,6S,7S,9R)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
|---|---|
| PubChem CID | 21174865 |
| Molecular Formula | C22H25NO7 |
| Molecular Weight | 415.44 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | [2-(4-butoxycarbonylanilino)-2-oxoethyl] (1R,3R,6S,7S,9R)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)COC(=O)[C@@H]2[C@@H]3C[C@H]4[C@@H]2C(=O)O[C@@H]4C3)cc1 |
| InChI | InChI=1S/C22H25NO7/c1-2-3-8-28-20(25)12-4-6-14(7-5-12)23-17(24)11-29-21(26)18-13-9-15-16(10-13)30-22(27)19(15)18/h4-7,13,15-16,18-19H,2-3,8-11H2,1H3,(H,23,24)/t13-,15-,16-,18-,19+/m1/s1 |
| InChIKey | LSDOFKJGDRVGSS-DZLVSBGCSA-N |
| XLogP | 2.32 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.44 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|