C18H18N4O3S2 — CID 21179584
(E)-N'-(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)-2-phenylethenesulfonohydrazide (PubChem CID 21179584) has the molecular formula C18H18N4O3S2 and a molecular weight of 402.50 g/mol. Its IUPAC name is (E)-N'-(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)-2-phenylethenesulfonohydrazide.
| Compound Name | (E)-N'-(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)-2-phenylethenesulfonohydrazide |
|---|---|
| PubChem CID | 21179584 |
| Molecular Formula | C18H18N4O3S2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | (E)-N'-(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)-2-phenylethenesulfonohydrazide |
| SMILES | O=c1[nH]c(NNS(=O)(=O)/C=C/c2ccccc2)nc2sc3c(c12)CCCC3 |
| InChI | InChI=1S/C18H18N4O3S2/c23-16-15-13-8-4-5-9-14(13)26-17(15)20-18(19-16)21-22-27(24,25)11-10-12-6-2-1-3-7-12/h1-3,6-7,10-11,22H,4-5,8-9H2,(H2,19,20,21,23)/b11-10+ |
| InChIKey | OGJUYVYCPJAITN-ZHACJKMWSA-N |
| XLogP | 2.78 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|