N,N-diethyl-1,1-dioxothiolan-3-amine chloride

C8H17ClNO2S- — CID 21179723

IUPACN,N-diethyl-1,1-dioxothiolan-3-amine chloride
SMILESCCN(CC)C1CCS(=O)(=O)C1.[Cl-]
InChIInChI=1S/C8H17NO2S.ClH/c1-3-9(4-2)8-5-6-12(10,11)7-8;/h8H,3-7H2,1-2H3;1H/p-1
InChIKeyNJTNUZWRCPJSOJ-UHFFFAOYSA-M
MW226.75 g/mol
LogP
Rot. Bonds3

About N,N-diethyl-1,1-dioxothiolan-3-amine chloride

N,N-diethyl-1,1-dioxothiolan-3-amine chloride (PubChem CID 21179723) has the molecular formula C8H17ClNO2S- and a molecular weight of 226.75 g/mol. Its IUPAC name is N,N-diethyl-1,1-dioxothiolan-3-amine chloride.

Molecular Properties

Compound NameN,N-diethyl-1,1-dioxothiolan-3-amine chloride
PubChem CID21179723
Molecular FormulaC8H17ClNO2S-
Molecular Weight226.75 g/mol
Exact Mass226.07
IUPAC NameN,N-diethyl-1,1-dioxothiolan-3-amine chloride
SMILESCCN(CC)C1CCS(=O)(=O)C1.[Cl-]
InChIInChI=1S/C8H17NO2S.ClH/c1-3-9(4-2)8-5-6-12(10,11)7-8;/h8H,3-7H2,1-2H3;1H/p-1
InChIKeyNJTNUZWRCPJSOJ-UHFFFAOYSA-M
XLogP
TPSA45.80 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms13
Complexity226

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500226.75
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze N,N-diethyl-1,1-dioxothiolan-3-amine chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N,N-diethyl-1,1-dioxothiolan-3-amine chloride?
The IUPAC name of N,N-diethyl-1,1-dioxothiolan-3-amine chloride (CID 21179723) is N,N-diethyl-1,1-dioxothiolan-3-amine chloride.
What is the SMILES notation for N,N-diethyl-1,1-dioxothiolan-3-amine chloride?
The canonical SMILES for N,N-diethyl-1,1-dioxothiolan-3-amine chloride is CCN(CC)C1CCS(=O)(=O)C1.[Cl-].
What is the InChIKey of N,N-diethyl-1,1-dioxothiolan-3-amine chloride?
The InChIKey is NJTNUZWRCPJSOJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H17NO2S.ClH/c1-3-9(4-2)8-5-6-12(10,11)7-8;/h8H,3-7H2,1-2H3;1H/p-1.
What are the key properties of N,N-diethyl-1,1-dioxothiolan-3-amine chloride?
N,N-diethyl-1,1-dioxothiolan-3-amine chloride has a molecular weight of 226.75 g/mol, XLogP of not available, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyl-1,1-dioxothiolan-3-amine chloride is sourced from PubChem (CID 21179723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).