C8H17ClNO2S- — CID 21179723
N,N-diethyl-1,1-dioxothiolan-3-amine chloride (PubChem CID 21179723) has the molecular formula C8H17ClNO2S- and a molecular weight of 226.75 g/mol. Its IUPAC name is N,N-diethyl-1,1-dioxothiolan-3-amine chloride.
| Compound Name | N,N-diethyl-1,1-dioxothiolan-3-amine chloride |
|---|---|
| PubChem CID | 21179723 |
| Molecular Formula | C8H17ClNO2S- |
| Molecular Weight | 226.75 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | N,N-diethyl-1,1-dioxothiolan-3-amine chloride |
| SMILES | CCN(CC)C1CCS(=O)(=O)C1.[Cl-] |
| InChI | InChI=1S/C8H17NO2S.ClH/c1-3-9(4-2)8-5-6-12(10,11)7-8;/h8H,3-7H2,1-2H3;1H/p-1 |
| InChIKey | NJTNUZWRCPJSOJ-UHFFFAOYSA-M |
| XLogP | — |
| TPSA | 45.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | 226 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |