C9H18ClN2O2S- — CID 21179766
N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-N',N'-dimethylpropane-1,3-diamine chloride (PubChem CID 21179766) has the molecular formula C9H18ClN2O2S- and a molecular weight of 253.77 g/mol. Its IUPAC name is N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-N',N'-dimethylpropane-1,3-diamine chloride.
| Compound Name | N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-N',N'-dimethylpropane-1,3-diamine chloride |
|---|---|
| PubChem CID | 21179766 |
| Molecular Formula | C9H18ClN2O2S- |
| Molecular Weight | 253.77 g/mol |
| Exact Mass | 253.08 |
| IUPAC Name | N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-N',N'-dimethylpropane-1,3-diamine chloride |
| SMILES | CN(C)CCCNC1C=CS(=O)(=O)C1.[Cl-] |
| InChI | InChI=1S/C9H18N2O2S.ClH/c1-11(2)6-3-5-10-9-4-7-14(12,13)8-9;/h4,7,9-10H,3,5-6,8H2,1-2H3;1H/p-1 |
| InChIKey | LFQKMFXTLIWCLN-UHFFFAOYSA-M |
| XLogP | -3.16 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.77 |
| LogP ≤ 5 | -3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|