C8H17ClNO3S- — CID 21179787
4-(2-methylpropylamino)-1,1-dioxothiolan-3-ol chloride (PubChem CID 21179787) has the molecular formula C8H17ClNO3S- and a molecular weight of 242.75 g/mol. Its IUPAC name is 4-(2-methylpropylamino)-1,1-dioxothiolan-3-ol chloride.
| Compound Name | 4-(2-methylpropylamino)-1,1-dioxothiolan-3-ol chloride |
|---|---|
| PubChem CID | 21179787 |
| Molecular Formula | C8H17ClNO3S- |
| Molecular Weight | 242.75 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | 4-(2-methylpropylamino)-1,1-dioxothiolan-3-ol chloride |
| SMILES | CC(C)CNC1CS(=O)(=O)CC1O.[Cl-] |
| InChI | InChI=1S/C8H17NO3S.ClH/c1-6(2)3-9-7-4-13(11,12)5-8(7)10;/h6-10H,3-5H2,1-2H3;1H/p-1 |
| InChIKey | MONXHJVICMVKOM-UHFFFAOYSA-M |
| XLogP | -3.61 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.75 |
| LogP ≤ 5 | -3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |