C23H24ClN5 — CID 21180256
3-[3-(pyrrolidin-1-ylmethyl)phenyl]-5-(4-pyrrol-1-ylphenyl)-1H-1,2,4-triazole;hydrochloride (PubChem CID 21180256) has the molecular formula C23H24ClN5 and a molecular weight of 405.93 g/mol. Its IUPAC name is 3-[3-(pyrrolidin-1-ylmethyl)phenyl]-5-(4-pyrrol-1-ylphenyl)-1H-1,2,4-triazole;hydrochloride.
| Compound Name | 3-[3-(pyrrolidin-1-ylmethyl)phenyl]-5-(4-pyrrol-1-ylphenyl)-1H-1,2,4-triazole;hydrochloride |
|---|---|
| PubChem CID | 21180256 |
| Molecular Formula | C23H24ClN5 |
| Molecular Weight | 405.93 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | 3-[3-(pyrrolidin-1-ylmethyl)phenyl]-5-(4-pyrrol-1-ylphenyl)-1H-1,2,4-triazole;hydrochloride |
| SMILES | Cl.c1cc(CN2CCCC2)cc(-c2n[nH]c(-c3ccc(-n4cccc4)cc3)n2)c1 |
| InChI | InChI=1S/C23H23N5.ClH/c1-2-13-27(12-1)17-18-6-5-7-20(16-18)23-24-22(25-26-23)19-8-10-21(11-9-19)28-14-3-4-15-28;/h3-11,14-16H,1-2,12-13,17H2,(H,24,25,26);1H |
| InChIKey | FALZPGKHZSKGEY-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 49.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.93 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_G(4)', 'substructure': 'N/A'} |
|---|