C18H15F2N3O2 — CID 21180395
3-[2-(2,2-difluoroethyl)-5-(4-methoxyphenyl)-1,2,4-triazol-3-yl]benzaldehyde (PubChem CID 21180395) has the molecular formula C18H15F2N3O2 and a molecular weight of 343.33 g/mol. Its IUPAC name is 3-[2-(2,2-difluoroethyl)-5-(4-methoxyphenyl)-1,2,4-triazol-3-yl]benzaldehyde.
| Compound Name | 3-[2-(2,2-difluoroethyl)-5-(4-methoxyphenyl)-1,2,4-triazol-3-yl]benzaldehyde |
|---|---|
| PubChem CID | 21180395 |
| Molecular Formula | C18H15F2N3O2 |
| Molecular Weight | 343.33 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 3-[2-(2,2-difluoroethyl)-5-(4-methoxyphenyl)-1,2,4-triazol-3-yl]benzaldehyde |
| SMILES | COc1ccc(-c2nc(-c3cccc(C=O)c3)n(CC(F)F)n2)cc1 |
| InChI | InChI=1S/C18H15F2N3O2/c1-25-15-7-5-13(6-8-15)17-21-18(23(22-17)10-16(19)20)14-4-2-3-12(9-14)11-24/h2-9,11,16H,10H2,1H3 |
| InChIKey | XXVXJYNVPBZZKR-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.33 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|