C21H22N4O — CID 21180455
1-[3-[5-(4-methoxyphenyl)-1-prop-2-ynyl-1,2,4-triazol-3-yl]phenyl]-N,N-dimethylmethanamine (PubChem CID 21180455) has the molecular formula C21H22N4O and a molecular weight of 346.43 g/mol. Its IUPAC name is 1-[3-[5-(4-methoxyphenyl)-1-prop-2-ynyl-1,2,4-triazol-3-yl]phenyl]-N,N-dimethylmethanamine.
| Compound Name | 1-[3-[5-(4-methoxyphenyl)-1-prop-2-ynyl-1,2,4-triazol-3-yl]phenyl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 21180455 |
| Molecular Formula | C21H22N4O |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 1-[3-[5-(4-methoxyphenyl)-1-prop-2-ynyl-1,2,4-triazol-3-yl]phenyl]-N,N-dimethylmethanamine |
| SMILES | C#CCn1nc(-c2cccc(CN(C)C)c2)nc1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C21H22N4O/c1-5-13-25-21(17-9-11-19(26-4)12-10-17)22-20(23-25)18-8-6-7-16(14-18)15-24(2)3/h1,6-12,14H,13,15H2,2-4H3 |
| InChIKey | SRVGZWMVBWYWOJ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|