C18H18F2N2O2S — CID 21187866
3-cyclopentyloxy-N-(3,5-difluoro-4-pyridinyl)-4-methylsulfanylbenzamide (PubChem CID 21187866) has the molecular formula C18H18F2N2O2S and a molecular weight of 364.42 g/mol. Its IUPAC name is 3-cyclopentyloxy-N-(3,5-difluoro-4-pyridinyl)-4-methylsulfanylbenzamide.
| Compound Name | 3-cyclopentyloxy-N-(3,5-difluoro-4-pyridinyl)-4-methylsulfanylbenzamide |
|---|---|
| PubChem CID | 21187866 |
| Molecular Formula | C18H18F2N2O2S |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 3-cyclopentyloxy-N-(3,5-difluoro-4-pyridinyl)-4-methylsulfanylbenzamide |
| SMILES | CSc1ccc(C(=O)Nc2c(F)cncc2F)cc1OC1CCCC1 |
| InChI | InChI=1S/C18H18F2N2O2S/c1-25-16-7-6-11(8-15(16)24-12-4-2-3-5-12)18(23)22-17-13(19)9-21-10-14(17)20/h6-10,12H,2-5H2,1H3,(H,21,22,23) |
| InChIKey | SOZNNNYGIKAICB-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |