C30H40ClN3O3 — CID 21188499
tert-butyl 4-[4-[2-[(4-chlorophenoxy)methyl]-4,5-dimethylbenzimidazol-1-yl]butyl]piperidine-1-carboxylate (PubChem CID 21188499) has the molecular formula C30H40ClN3O3 and a molecular weight of 526.12 g/mol. Its IUPAC name is tert-butyl 4-[4-[2-[(4-chlorophenoxy)methyl]-4,5-dimethylbenzimidazol-1-yl]butyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[2-[(4-chlorophenoxy)methyl]-4,5-dimethylbenzimidazol-1-yl]butyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 21188499 |
| Molecular Formula | C30H40ClN3O3 |
| Molecular Weight | 526.12 g/mol |
| Exact Mass | 525.28 |
| IUPAC Name | tert-butyl 4-[4-[2-[(4-chlorophenoxy)methyl]-4,5-dimethylbenzimidazol-1-yl]butyl]piperidine-1-carboxylate |
| SMILES | Cc1ccc2c(nc(COc3ccc(Cl)cc3)n2CCCCC2CCN(C(=O)OC(C)(C)C)CC2)c1C |
| InChI | InChI=1S/C30H40ClN3O3/c1-21-9-14-26-28(22(21)2)32-27(20-36-25-12-10-24(31)11-13-25)34(26)17-7-6-8-23-15-18-33(19-16-23)29(35)37-30(3,4)5/h9-14,23H,6-8,15-20H2,1-5H3 |
| InChIKey | JDPVJBDGMUBDNC-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.12 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|