C28H38N4O3 — CID 21188643
tert-butyl 3-[3-[2-[(4-aminophenoxy)methyl]-4-methylbenzimidazol-1-yl]propyl]piperidine-1-carboxylate (PubChem CID 21188643) has the molecular formula C28H38N4O3 and a molecular weight of 478.64 g/mol. Its IUPAC name is tert-butyl 3-[3-[2-[(4-aminophenoxy)methyl]-4-methylbenzimidazol-1-yl]propyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[3-[2-[(4-aminophenoxy)methyl]-4-methylbenzimidazol-1-yl]propyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 21188643 |
| Molecular Formula | C28H38N4O3 |
| Molecular Weight | 478.64 g/mol |
| Exact Mass | 478.29 |
| IUPAC Name | tert-butyl 3-[3-[2-[(4-aminophenoxy)methyl]-4-methylbenzimidazol-1-yl]propyl]piperidine-1-carboxylate |
| SMILES | Cc1cccc2c1nc(COc1ccc(N)cc1)n2CCCC1CCCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C28H38N4O3/c1-20-8-5-11-24-26(20)30-25(19-34-23-14-12-22(29)13-15-23)32(24)17-7-10-21-9-6-16-31(18-21)27(33)35-28(2,3)4/h5,8,11-15,21H,6-7,9-10,16-19,29H2,1-4H3 |
| InChIKey | FYJNDYIKKPFQEI-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.64 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|