C30H39ClN4O3 — CID 21188779
3-[2-[(4-chlorophenoxy)methyl]-4-methylbenzimidazol-1-yl]propyl 2-(4-cyclohexylpiperazin-1-yl)acetate (PubChem CID 21188779) has the molecular formula C30H39ClN4O3 and a molecular weight of 539.12 g/mol. Its IUPAC name is 3-[2-[(4-chlorophenoxy)methyl]-4-methylbenzimidazol-1-yl]propyl 2-(4-cyclohexylpiperazin-1-yl)acetate.
| Compound Name | 3-[2-[(4-chlorophenoxy)methyl]-4-methylbenzimidazol-1-yl]propyl 2-(4-cyclohexylpiperazin-1-yl)acetate |
|---|---|
| PubChem CID | 21188779 |
| Molecular Formula | C30H39ClN4O3 |
| Molecular Weight | 539.12 g/mol |
| Exact Mass | 538.27 |
| IUPAC Name | 3-[2-[(4-chlorophenoxy)methyl]-4-methylbenzimidazol-1-yl]propyl 2-(4-cyclohexylpiperazin-1-yl)acetate |
| SMILES | Cc1cccc2c1nc(COc1ccc(Cl)cc1)n2CCCOC(=O)CN1CCN(C2CCCCC2)CC1 |
| InChI | InChI=1S/C30H39ClN4O3/c1-23-7-5-10-27-30(23)32-28(22-38-26-13-11-24(31)12-14-26)35(27)15-6-20-37-29(36)21-33-16-18-34(19-17-33)25-8-3-2-4-9-25/h5,7,10-14,25H,2-4,6,8-9,15-22H2,1H3 |
| InChIKey | LJVWGGGYUSCPNF-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 59.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.12 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|