C24H40N3O4S- — CID 21188875
decanoate;1-[3-[2-(dimethylamino)ethyl]-1H-indol-5-yl]-N-methylmethanesulfonamide (PubChem CID 21188875) has the molecular formula C24H40N3O4S- and a molecular weight of 466.67 g/mol. Its IUPAC name is decanoate;1-[3-[2-(dimethylamino)ethyl]-1H-indol-5-yl]-N-methylmethanesulfonamide.
| Compound Name | decanoate;1-[3-[2-(dimethylamino)ethyl]-1H-indol-5-yl]-N-methylmethanesulfonamide |
|---|---|
| PubChem CID | 21188875 |
| Molecular Formula | C24H40N3O4S- |
| Molecular Weight | 466.67 g/mol |
| Exact Mass | 466.27 |
| IUPAC Name | decanoate;1-[3-[2-(dimethylamino)ethyl]-1H-indol-5-yl]-N-methylmethanesulfonamide |
| SMILES | CCCCCCCCCC(=O)[O-].CNS(=O)(=O)Cc1ccc2[nH]cc(CCN(C)C)c2c1 |
| InChI | InChI=1S/C14H21N3O2S.C10H20O2/c1-15-20(18,19)10-11-4-5-14-13(8-11)12(9-16-14)6-7-17(2)3;1-2-3-4-5-6-7-8-9-10(11)12/h4-5,8-9,15-16H,6-7,10H2,1-3H3;2-9H2,1H3,(H,11,12)/p-1 |
| InChIKey | DJKQNUYBMBBUCK-UHFFFAOYSA-M |
| XLogP | 3.20 |
| TPSA | 105.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.67 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|