C22H29N3O9S — CID 87259431
4-[4-[[3-[2-(dimethylamino)ethyl]-1H-indol-5-yl]methylsulfonyl-methylamino]oxy-4-oxobutanoyl]oxy-4-oxobutanoic acid (PubChem CID 87259431) has the molecular formula C22H29N3O9S and a molecular weight of 511.55 g/mol. Its IUPAC name is 4-[4-[[3-[2-(dimethylamino)ethyl]-1H-indol-5-yl]methylsulfonyl-methylamino]oxy-4-oxobutanoyl]oxy-4-oxobutanoic acid.
| Compound Name | 4-[4-[[3-[2-(dimethylamino)ethyl]-1H-indol-5-yl]methylsulfonyl-methylamino]oxy-4-oxobutanoyl]oxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 87259431 |
| Molecular Formula | C22H29N3O9S |
| Molecular Weight | 511.55 g/mol |
| Exact Mass | 511.16 |
| IUPAC Name | 4-[4-[[3-[2-(dimethylamino)ethyl]-1H-indol-5-yl]methylsulfonyl-methylamino]oxy-4-oxobutanoyl]oxy-4-oxobutanoic acid |
| SMILES | CN(C)CCc1c[nH]c2ccc(CS(=O)(=O)N(C)OC(=O)CCC(=O)OC(=O)CCC(=O)O)cc12 |
| InChI | InChI=1S/C22H29N3O9S/c1-24(2)11-10-16-13-23-18-5-4-15(12-17(16)18)14-35(31,32)25(3)34-22(30)9-8-21(29)33-20(28)7-6-19(26)27/h4-5,12-13,23H,6-11,14H2,1-3H3,(H,26,27) |
| InChIKey | NIIDIQKRQIJZOM-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 163.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.55 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|