C26H22BrN5OS — CID 2119060
3-[2-(3-bromophenoxy)ethylsulfanyl]-5-[2-(4-methylphenyl)quinolin-4-yl]-1,2,4-triazol-4-amine (PubChem CID 2119060) has the molecular formula C26H22BrN5OS and a molecular weight of 532.47 g/mol. Its IUPAC name is 3-[2-(3-bromophenoxy)ethylsulfanyl]-5-[2-(4-methylphenyl)quinolin-4-yl]-1,2,4-triazol-4-amine.
| Compound Name | 3-[2-(3-bromophenoxy)ethylsulfanyl]-5-[2-(4-methylphenyl)quinolin-4-yl]-1,2,4-triazol-4-amine |
|---|---|
| PubChem CID | 2119060 |
| Molecular Formula | C26H22BrN5OS |
| Molecular Weight | 532.47 g/mol |
| Exact Mass | 531.07 |
| IUPAC Name | 3-[2-(3-bromophenoxy)ethylsulfanyl]-5-[2-(4-methylphenyl)quinolin-4-yl]-1,2,4-triazol-4-amine |
| SMILES | Cc1ccc(-c2cc(-c3nnc(SCCOc4cccc(Br)c4)n3N)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C26H22BrN5OS/c1-17-9-11-18(12-10-17)24-16-22(21-7-2-3-8-23(21)29-24)25-30-31-26(32(25)28)34-14-13-33-20-6-4-5-19(27)15-20/h2-12,15-16H,13-14,28H2,1H3 |
| InChIKey | VRNLHISSSWNOMT-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.47 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|