C48H52N2S2 — CID 21192173
N,N'-bis(2-methyl-2-tritylsulfanylpropyl)ethane-1,2-diamine (PubChem CID 21192173) has the molecular formula C48H52N2S2 and a molecular weight of 721.09 g/mol. Its IUPAC name is N,N'-bis(2-methyl-2-tritylsulfanylpropyl)ethane-1,2-diamine.
| Compound Name | N,N'-bis(2-methyl-2-tritylsulfanylpropyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 21192173 |
| Molecular Formula | C48H52N2S2 |
| Molecular Weight | 721.09 g/mol |
| Exact Mass | 720.36 |
| IUPAC Name | N,N'-bis(2-methyl-2-tritylsulfanylpropyl)ethane-1,2-diamine |
| SMILES | CC(C)(CNCCNCC(C)(C)SC(c1ccccc1)(c1ccccc1)c1ccccc1)SC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C48H52N2S2/c1-45(2,51-47(39-23-11-5-12-24-39,40-25-13-6-14-26-40)41-27-15-7-16-28-41)37-49-35-36-50-38-46(3,4)52-48(42-29-17-8-18-30-42,43-31-19-9-20-32-43)44-33-21-10-22-34-44/h5-34,49-50H,35-38H2,1-4H3 |
| InChIKey | CHMOFUPEUXLXRW-UHFFFAOYSA-N |
| XLogP | 11.17 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.09 |
| LogP ≤ 5 | 11.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|