C53H60N2O2S2 — CID 54138276
5-[(2-methyl-2-tritylsulfanylpropyl)-[2-[(2-methyl-2-tritylsulfanylpropyl)amino]ethyl]amino]pentanoic acid (PubChem CID 54138276) has the molecular formula C53H60N2O2S2 and a molecular weight of 821.21 g/mol. Its IUPAC name is 5-[(2-methyl-2-tritylsulfanylpropyl)-[2-[(2-methyl-2-tritylsulfanylpropyl)amino]ethyl]amino]pentanoic acid.
| Compound Name | 5-[(2-methyl-2-tritylsulfanylpropyl)-[2-[(2-methyl-2-tritylsulfanylpropyl)amino]ethyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 54138276 |
| Molecular Formula | C53H60N2O2S2 |
| Molecular Weight | 821.21 g/mol |
| Exact Mass | 820.41 |
| IUPAC Name | 5-[(2-methyl-2-tritylsulfanylpropyl)-[2-[(2-methyl-2-tritylsulfanylpropyl)amino]ethyl]amino]pentanoic acid |
| SMILES | CC(C)(CNCCN(CCCCC(=O)O)CC(C)(C)SC(c1ccccc1)(c1ccccc1)c1ccccc1)SC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C53H60N2O2S2/c1-50(2,58-52(43-25-11-5-12-26-43,44-27-13-6-14-28-44)45-29-15-7-16-30-45)41-54-38-40-55(39-24-23-37-49(56)57)42-51(3,4)59-53(46-31-17-8-18-32-46,47-33-19-9-20-34-47)48-35-21-10-22-36-48/h5-22,25-36,54H,23-24,37-42H2,1-4H3,(H,56,57) |
| InChIKey | NZGKDYTUADZILL-UHFFFAOYSA-N |
| XLogP | 12.14 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 821.21 |
| LogP ≤ 5 | 12.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|