C58H74N4 — CID 11828900
N,N'-bis(2,2-dimethylpropyl)-N,N'-bis[3-(tritylamino)propyl]butane-1,4-diamine (PubChem CID 11828900) has the molecular formula C58H74N4 and a molecular weight of 827.26 g/mol. Its IUPAC name is N,N'-bis(2,2-dimethylpropyl)-N,N'-bis[3-(tritylamino)propyl]butane-1,4-diamine.
| Compound Name | N,N'-bis(2,2-dimethylpropyl)-N,N'-bis[3-(tritylamino)propyl]butane-1,4-diamine |
|---|---|
| PubChem CID | 11828900 |
| Molecular Formula | C58H74N4 |
| Molecular Weight | 827.26 g/mol |
| Exact Mass | 826.59 |
| IUPAC Name | N,N'-bis(2,2-dimethylpropyl)-N,N'-bis[3-(tritylamino)propyl]butane-1,4-diamine |
| SMILES | CC(C)(C)CN(CCCCN(CCCNC(c1ccccc1)(c1ccccc1)c1ccccc1)CC(C)(C)C)CCCNC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C58H74N4/c1-55(2,3)47-61(45-27-41-59-57(49-29-13-7-14-30-49,50-31-15-8-16-32-50)51-33-17-9-18-34-51)43-25-26-44-62(48-56(4,5)6)46-28-42-60-58(52-35-19-10-20-36-52,53-37-21-11-22-38-53)54-39-23-12-24-40-54/h7-24,29-40,59-60H,25-28,41-48H2,1-6H3 |
| InChIKey | MFRPEIZDPIFWQX-UHFFFAOYSA-N |
| XLogP | 12.41 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 827.26 |
| LogP ≤ 5 | 12.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|