C15H32N2O2S2 — CID 54327344
5-[2-[bis(2-methyl-2-sulfanylpropyl)amino]ethylamino]pentanoic acid (PubChem CID 54327344) has the molecular formula C15H32N2O2S2 and a molecular weight of 336.57 g/mol. Its IUPAC name is 5-[2-[bis(2-methyl-2-sulfanylpropyl)amino]ethylamino]pentanoic acid.
| Compound Name | 5-[2-[bis(2-methyl-2-sulfanylpropyl)amino]ethylamino]pentanoic acid |
|---|---|
| PubChem CID | 54327344 |
| Molecular Formula | C15H32N2O2S2 |
| Molecular Weight | 336.57 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | 5-[2-[bis(2-methyl-2-sulfanylpropyl)amino]ethylamino]pentanoic acid |
| SMILES | CC(C)(S)CN(CCNCCCCC(=O)O)CC(C)(C)S |
| InChI | InChI=1S/C15H32N2O2S2/c1-14(2,20)11-17(12-15(3,4)21)10-9-16-8-6-5-7-13(18)19/h16,20-21H,5-12H2,1-4H3,(H,18,19) |
| InChIKey | SVWOIKZCEWJRSX-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.57 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|