About 4-pyrazol-1-ylpiperidine
4-pyrazol-1-ylpiperidine (PubChem CID 21193045) has the molecular formula C8H13N3
and a molecular weight of 151.21 g/mol. Its IUPAC name is 4-pyrazol-1-ylpiperidine.
Molecular Properties
| Compound Name | 4-pyrazol-1-ylpiperidine |
| PubChem CID | 21193045 |
| Molecular Formula | C8H13N3 |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.11 |
| IUPAC Name | 4-pyrazol-1-ylpiperidine |
| SMILES | c1cnn(C2CCNCC2)c1 |
| InChI | InChI=1S/C8H13N3/c1-4-10-11(7-1)8-2-5-9-6-3-8/h1,4,7-9H,2-3,5-6H2 |
| InChIKey | WGNPNAOPVBYTKD-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-pyrazol-1-ylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-pyrazol-1-ylpiperidine?
The IUPAC name of 4-pyrazol-1-ylpiperidine (CID 21193045) is 4-pyrazol-1-ylpiperidine.
What is the SMILES notation for 4-pyrazol-1-ylpiperidine?
The canonical SMILES for 4-pyrazol-1-ylpiperidine is c1cnn(C2CCNCC2)c1.
What is the InChIKey of 4-pyrazol-1-ylpiperidine?
The InChIKey is WGNPNAOPVBYTKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3/c1-4-10-11(7-1)8-2-5-9-6-3-8/h1,4,7-9H,2-3,5-6H2.
What are the key properties of 4-pyrazol-1-ylpiperidine?
4-pyrazol-1-ylpiperidine has a molecular weight of 151.21 g/mol, XLogP of 0.81, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-pyrazol-1-ylpiperidine is sourced from PubChem (CID 21193045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).