C20H19N3O6S — CID 2119478
4-amino-2-(2-methyl-5-morpholin-4-ylsulfonylbenzoyl)isoindole-1,3-dione (PubChem CID 2119478) has the molecular formula C20H19N3O6S and a molecular weight of 429.45 g/mol. Its IUPAC name is 4-amino-2-(2-methyl-5-morpholin-4-ylsulfonylbenzoyl)isoindole-1,3-dione.
| Compound Name | 4-amino-2-(2-methyl-5-morpholin-4-ylsulfonylbenzoyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 2119478 |
| Molecular Formula | C20H19N3O6S |
| Molecular Weight | 429.45 g/mol |
| Exact Mass | 429.10 |
| IUPAC Name | 4-amino-2-(2-methyl-5-morpholin-4-ylsulfonylbenzoyl)isoindole-1,3-dione |
| SMILES | Cc1ccc(S(=O)(=O)N2CCOCC2)cc1C(=O)N1C(=O)c2cccc(N)c2C1=O |
| InChI | InChI=1S/C20H19N3O6S/c1-12-5-6-13(30(27,28)22-7-9-29-10-8-22)11-15(12)19(25)23-18(24)14-3-2-4-16(21)17(14)20(23)26/h2-6,11H,7-10,21H2,1H3 |
| InChIKey | USVOWHZUYRCNTO-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 127.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.45 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|