C19H29ClFNO3 — CID 21196096
tert-butyl N-[4-[(5-chloro-2-fluorophenyl)methoxy]butyl]-N-propan-2-ylcarbamate (PubChem CID 21196096) has the molecular formula C19H29ClFNO3 and a molecular weight of 373.90 g/mol. Its IUPAC name is tert-butyl N-[4-[(5-chloro-2-fluorophenyl)methoxy]butyl]-N-propan-2-ylcarbamate.
| Compound Name | tert-butyl N-[4-[(5-chloro-2-fluorophenyl)methoxy]butyl]-N-propan-2-ylcarbamate |
|---|---|
| PubChem CID | 21196096 |
| Molecular Formula | C19H29ClFNO3 |
| Molecular Weight | 373.90 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | tert-butyl N-[4-[(5-chloro-2-fluorophenyl)methoxy]butyl]-N-propan-2-ylcarbamate |
| SMILES | CC(C)N(CCCCOCc1cc(Cl)ccc1F)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H29ClFNO3/c1-14(2)22(18(23)25-19(3,4)5)10-6-7-11-24-13-15-12-16(20)8-9-17(15)21/h8-9,12,14H,6-7,10-11,13H2,1-5H3 |
| InChIKey | BYJYZACQRXERJA-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.90 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|