C20H29ClFNO3 — CID 58247009
tert-butyl (3R)-3-[(3-chloro-2-fluorophenyl)-propoxymethyl]piperidine-1-carboxylate (PubChem CID 58247009) has the molecular formula C20H29ClFNO3 and a molecular weight of 385.91 g/mol. Its IUPAC name is tert-butyl (3R)-3-[(3-chloro-2-fluorophenyl)-propoxymethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[(3-chloro-2-fluorophenyl)-propoxymethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 58247009 |
| Molecular Formula | C20H29ClFNO3 |
| Molecular Weight | 385.91 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | tert-butyl (3R)-3-[(3-chloro-2-fluorophenyl)-propoxymethyl]piperidine-1-carboxylate |
| SMILES | CCCOC(c1cccc(Cl)c1F)[C@@H]1CCCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C20H29ClFNO3/c1-5-12-25-18(15-9-6-10-16(21)17(15)22)14-8-7-11-23(13-14)19(24)26-20(2,3)4/h6,9-10,14,18H,5,7-8,11-13H2,1-4H3/t14-,18?/m1/s1 |
| InChIKey | ZXZRZXMCFREAOA-IKJXHCRLSA-N |
| XLogP | 5.59 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.91 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |