About ethyl 2,3,7-tricyano-1H-pyrrolo[1,2-a]imidazole-6-carboxylate
ethyl 2,3,7-tricyano-1H-pyrrolo[1,2-a]imidazole-6-carboxylate (PubChem CID 21200987) has the molecular formula C12H7N5O2
and a molecular weight of 253.22 g/mol. Its IUPAC name is ethyl 2,3,7-tricyano-1H-pyrrolo[1,2-a]imidazole-6-carboxylate.
Analyze ethyl 2,3,7-tricyano-1H-pyrrolo[1,2-a]imidazole-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2,3,7-tricyano-1H-pyrrolo[1,2-a]imidazole-6-carboxylate?
The IUPAC name of ethyl 2,3,7-tricyano-1H-pyrrolo[1,2-a]imidazole-6-carboxylate (CID 21200987) is ethyl 2,3,7-tricyano-1H-pyrrolo[1,2-a]imidazole-6-carboxylate.
What is the SMILES notation for ethyl 2,3,7-tricyano-1H-pyrrolo[1,2-a]imidazole-6-carboxylate?
The canonical SMILES for ethyl 2,3,7-tricyano-1H-pyrrolo[1,2-a]imidazole-6-carboxylate is CCOC(=O)c1cn2c(C#N)c(C#N)[nH]c2c1C#N.
What is the InChIKey of ethyl 2,3,7-tricyano-1H-pyrrolo[1,2-a]imidazole-6-carboxylate?
The InChIKey is XXFKRSZKVCSQKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7N5O2/c1-2-19-12(18)8-6-17-10(5-15)9(4-14)16-11(17)7(8)3-13/h6,16H,2H2,1H3.
What are the key properties of ethyl 2,3,7-tricyano-1H-pyrrolo[1,2-a]imidazole-6-carboxylate?
ethyl 2,3,7-tricyano-1H-pyrrolo[1,2-a]imidazole-6-carboxylate has a molecular weight of 253.22 g/mol, XLogP of 1.06, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2,3,7-tricyano-1H-pyrrolo[1,2-a]imidazole-6-carboxylate is sourced from PubChem (CID 21200987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).