C22H31N3O3 — CID 21201582
tert-butyl N-[5-[(2Z)-cyclooct-2-en-1-yl]-2-oxo-3,4-dihydro-1H-1,5-benzodiazepin-3-yl]carbamate (PubChem CID 21201582) has the molecular formula C22H31N3O3 and a molecular weight of 385.51 g/mol. Its IUPAC name is tert-butyl N-[5-[(2Z)-cyclooct-2-en-1-yl]-2-oxo-3,4-dihydro-1H-1,5-benzodiazepin-3-yl]carbamate.
| Compound Name | tert-butyl N-[5-[(2Z)-cyclooct-2-en-1-yl]-2-oxo-3,4-dihydro-1H-1,5-benzodiazepin-3-yl]carbamate |
|---|---|
| PubChem CID | 21201582 |
| Molecular Formula | C22H31N3O3 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | tert-butyl N-[5-[(2Z)-cyclooct-2-en-1-yl]-2-oxo-3,4-dihydro-1H-1,5-benzodiazepin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CN(C2/C=C\CCCCC2)c2ccccc2NC1=O |
| InChI | InChI=1S/C22H31N3O3/c1-22(2,3)28-21(27)24-18-15-25(16-11-7-5-4-6-8-12-16)19-14-10-9-13-17(19)23-20(18)26/h7,9-11,13-14,16,18H,4-6,8,12,15H2,1-3H3,(H,23,26)(H,24,27)/b11-7- |
| InChIKey | FDMFPVSTVMWSSO-XFFZJAGNSA-N |
| XLogP | 4.23 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|