C20H18N4O4S — CID 2120241
ethyl 3-[[1-(4-methoxyphenyl)tetrazol-5-yl]sulfanylmethyl]-1-benzofuran-2-carboxylate (PubChem CID 2120241) has the molecular formula C20H18N4O4S and a molecular weight of 410.46 g/mol. Its IUPAC name is ethyl 3-[[1-(4-methoxyphenyl)tetrazol-5-yl]sulfanylmethyl]-1-benzofuran-2-carboxylate.
| Compound Name | ethyl 3-[[1-(4-methoxyphenyl)tetrazol-5-yl]sulfanylmethyl]-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 2120241 |
| Molecular Formula | C20H18N4O4S |
| Molecular Weight | 410.46 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | ethyl 3-[[1-(4-methoxyphenyl)tetrazol-5-yl]sulfanylmethyl]-1-benzofuran-2-carboxylate |
| SMILES | CCOC(=O)c1oc2ccccc2c1CSc1nnnn1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C20H18N4O4S/c1-3-27-19(25)18-16(15-6-4-5-7-17(15)28-18)12-29-20-21-22-23-24(20)13-8-10-14(26-2)11-9-13/h4-11H,3,12H2,1-2H3 |
| InChIKey | HUTDRUDYXMLTQM-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 92.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.46 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |